CAS 893569-92-1

N-(2-ethoxybenzyl)prop-2-en-1-amine

Description:

N-(2-ethoxybenzyl)prop-2-en-1-amine is an organic compound characterized by its amine functional group and an alkene structure. It features a prop-2-en-1-amine backbone, which indicates the presence of a double bond between the second and third carbon atoms, contributing to its reactivity. The ethoxybenzyl substituent enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its behavior in chemical reactions and biological applications. Additionally, the presence of the ethoxy group can provide steric hindrance, impacting its reactivity and interaction with other molecules. Due to its structural features, N-(2-ethoxybenzyl)prop-2-en-1-amine may be of interest in medicinal chemistry and material science, where its unique properties can be harnessed for various applications. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₂H₁₇NO

InChI: InChI=1/C12H17NO/c1-3-9-13-10-11-7-5-6-8-12(11)14-4-2/h3,5-8,13H,1,4,9-10H2,2H3

SMILES: C=CCNCc1ccccc1OCC

Synonyms:

• benzenemethanamine, 2-ethoxy-N-2-propen-1-yl-

N-(2-ETHOXYBENZYL)-2-PROPEN-1-AMINE

CAS: 893569-92-1

Formula: C₁₂H₁₇NO

Molecular weight: 191.2695

Ref: IN-DA003XR4

N-(2-ethoxybenzyl)-2-propen-1-amine hydrochloride

CAS: 893569-92-1

Formula: C₁₂H₁₈ClNO

Purity: 95.0%

Molecular weight: 227.73

Ref: 10-F361684