CAS 893570-43-9
:N-(3-ethoxybenzyl)prop-2-en-1-amine
Description:
N-(3-ethoxybenzyl)prop-2-en-1-amine, identified by its CAS number 893570-43-9, is an organic compound characterized by its amine functional group and an alkenyl chain. This compound features a prop-2-en-1-amine backbone, which includes a double bond between the second and third carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the 3-ethoxybenzyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The ethoxy group can also affect the compound's solubility and stability. Typically, compounds like this may exhibit properties such as moderate to high boiling points and varying degrees of polarity, depending on the substituents attached. Its structural characteristics suggest potential uses in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. However, detailed studies on its toxicity, pharmacokinetics, and specific applications would be necessary to fully understand its potential in various fields.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-3-8-13-10-11-6-5-7-12(9-11)14-4-2/h3,5-7,9,13H,1,4,8,10H2,2H3
SMILES:C=CCNCc1cccc(c1)OCC
Synonyms:- benzenemethanamine, 3-ethoxy-N-2-propen-1-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
