CAS 893575-69-4

N-(2-chlorobenzyl)-2-methylpropan-1-amine

Description:

N-(2-chlorobenzyl)-2-methylpropan-1-amine, with the CAS number 893575-69-4, is an organic compound characterized by its amine functional group and a substituted benzyl moiety. This compound features a 2-chlorobenzyl group attached to a branched aliphatic amine, specifically 2-methylpropan-1-amine, which contributes to its unique chemical properties. The presence of the chlorine atom on the benzyl ring can influence the compound's reactivity and polarity, potentially affecting its solubility in various solvents. As an amine, it may exhibit basic properties and can participate in hydrogen bonding, which can impact its interactions in biological systems or chemical reactions. The compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on further research into its biological activity and chemical behavior. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₁H₁₆ClN

InChI: InChI=1/C11H16ClN/c1-9(2)7-13-8-10-5-3-4-6-11(10)12/h3-6,9,13H,7-8H2,1-2H3

SMILES: CC(C)CNCc1ccccc1Cl

Synonyms:

• benzenemethanamine, 2-chloro-N-(2-methylpropyl)-

(2-CHLOROBENZYL)ISOBUTYLAMINE

CAS: 893575-69-4

Formula: C₁₁H₁₆ClN

Molecular weight: 197.7044

Ref: IN-DA003XR0

N-(2-chlorobenzyl)-2-methyl-1-propanamine hydrochloride

CAS: 893575-69-4

Formula: C₁₁H₁₇Cl₂N

Purity: 95.0%

Molecular weight: 234.16

Ref: 10-F361735