CAS 893577-81-6
:N-(3-chlorobenzyl)-2-methylpropan-2-amine
Description:
N-(3-chlorobenzyl)-2-methylpropan-2-amine, identified by its CAS number 893577-81-6, is a chemical compound that belongs to the class of amines. It features a branched alkyl chain with a secondary amine functional group, which contributes to its basicity and potential reactivity. The presence of the 3-chlorobenzyl group enhances its lipophilicity, potentially influencing its interaction with biological systems. This compound may exhibit properties typical of amines, such as the ability to form salts with acids and participate in nucleophilic reactions. Its chlorobenzyl substituent can also impart unique electronic and steric effects, which may affect its pharmacological activity if studied in a biological context. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific characteristics such as solubility, melting point, and stability would require empirical data for precise evaluation. As with any chemical, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H16ClN
InChI:InChI=1/C11H16ClN/c1-11(2,3)13-8-9-5-4-6-10(12)7-9/h4-7,13H,8H2,1-3H3
SMILES:CC(C)(C)NCc1cccc(c1)Cl
Synonyms:- benzenemethanamine, 3-chloro-N-(1,1-dimethylethyl)-
- N-(3-Chlorophenylmethyl)tert-butylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
