CAS 893577-97-4
:N-(2-fluorobenzyl)-2-methylpropan-2-amine
Description:
N-(2-fluorobenzyl)-2-methylpropan-2-amine, with the CAS number 893577-97-4, is a chemical compound characterized by its amine functional group and a substituted benzyl moiety. This compound features a fluorine atom attached to the benzyl ring, which can influence its reactivity and biological activity. The presence of the bulky 2-methylpropan-2-amine structure contributes to its steric properties, potentially affecting its interaction with biological targets. As an amine, it may exhibit basicity and can participate in hydrogen bonding, which is significant for solubility and reactivity in various chemical environments. The fluorine substitution can enhance lipophilicity and alter the electronic properties of the molecule, making it of interest in medicinal chemistry and drug design. Additionally, the compound's structural characteristics suggest potential applications in pharmacology, particularly in the development of therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C11H16FN
InChI:InChI=1/C11H16FN/c1-11(2,3)13-8-9-6-4-5-7-10(9)12/h4-7,13H,8H2,1-3H3
SMILES:CC(C)(C)NCc1ccccc1F
Synonyms:- benzenemethanamine, N-(1,1-dimethylethyl)-2-fluoro-
- Tert-Butyl[(2-Fluorophenyl)Methyl]Amine
- N-(2-Fluorophenylmethyl)tert-butylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
