CAS 893581-54-9
:1-(5-bromo-2-ethoxyphenyl)-N-methylmethanamine
Description:
1-(5-bromo-2-ethoxyphenyl)-N-methylmethanamine, with the CAS number 893581-54-9, is a chemical compound that features a phenyl ring substituted with a bromine atom and an ethoxy group, along with a N-methylmethanamine moiety. This compound is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in medicinal chemistry. The presence of the bromine atom enhances its lipophilicity and may influence its pharmacokinetic properties. The ethoxy group contributes to the overall hydrophobic character of the molecule, while the N-methylmethanamine part introduces basicity, which can affect solubility and reactivity. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological function. Overall, this compound's unique structural features may provide insights into its potential applications in drug development or as a research tool in chemical biology.
Formula:C10H14BrNO
InChI:InChI=1/C10H14BrNO/c1-3-13-10-5-4-9(11)6-8(10)7-12-2/h4-6,12H,3,7H2,1-2H3
SMILES:CCOc1ccc(cc1CNC)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
