CymitQuimica logo

CAS 893581-95-8

:

N-(3-ethoxybenzyl)ethanamine

Description:
N-(3-ethoxybenzyl)ethanamine is an organic compound characterized by its amine functional group and an ethoxybenzyl substituent. It features a benzene ring with an ethoxy group (–O–C2H5) attached at the meta position relative to the amine group. This structure contributes to its potential as a ligand in various chemical reactions and biological applications. The presence of the ethoxy group enhances the compound's solubility in organic solvents, while the amine group can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. The compound may exhibit properties typical of amines, such as basicity and nucleophilicity, making it relevant in medicinal chemistry and drug design. Additionally, its specific stereochemistry and substituent effects can impact its biological activity, potentially making it a candidate for further research in pharmacology. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of N-(3-ethoxybenzyl)ethanamine have not been extensively characterized.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-3-12-9-10-6-5-7-11(8-10)13-4-2/h5-8,12H,3-4,9H2,1-2H3
SMILES:CCNCc1cccc(c1)OCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.