CAS 893587-03-6
:N-[(5-methylthiophen-2-yl)methyl]cyclopentanamine
Description:
N-[(5-methylthiophen-2-yl)methyl]cyclopentanamine is an organic compound characterized by its unique structure, which includes a cyclopentanamine moiety and a 5-methylthiophen-2-yl group. This compound features a cyclopentane ring, which contributes to its cyclic structure and potential conformational flexibility. The presence of the thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts distinct electronic properties and may enhance its reactivity and interaction with biological targets. The methyl group on the thiophene ring can influence the compound's lipophilicity and solubility. As a secondary amine, it may participate in hydrogen bonding, affecting its physical properties and potential applications in medicinal chemistry. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, N-[(5-methylthiophen-2-yl)methyl]cyclopentanamine represents a compound of interest for research in organic synthesis and pharmacology due to its structural features and potential biological activity.
Formula:C11H17NS
InChI:InChI=1/C11H17NS/c1-9-6-7-11(13-9)8-12-10-4-2-3-5-10/h6-7,10,12H,2-5,8H2,1H3
SMILES:Cc1ccc(CNC2CCCC2)s1
Synonyms:- 2-thiophenemethanamine, N-cyclopentyl-5-methyl-
- N-[(5-Methyl-2-thienyl)methyl]cyclopentanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
