CAS 893590-34-6
:N-(3-chlorobenzyl)butan-2-amine
Description:
N-(3-chlorobenzyl)butan-2-amine is an organic compound characterized by its amine functional group and a chlorobenzyl substituent. It features a butan-2-amine backbone, which indicates the presence of a butane chain with an amine group attached to the second carbon. The 3-chlorobenzyl group suggests that a chlorine atom is substituted on the benzene ring at the meta position relative to the amine attachment. This compound is likely to exhibit basic properties due to the amine group, allowing it to participate in hydrogen bonding and interact with various biological systems. Its structure may influence its solubility, reactivity, and potential applications in pharmaceuticals or as a chemical intermediate. The presence of the chlorine atom can also affect the compound's electronic properties and lipophilicity, which are important for its biological activity. Overall, N-(3-chlorobenzyl)butan-2-amine is a compound of interest in medicinal chemistry and may have implications in drug design and development.
Formula:C11H16ClN
InChI:InChI=1/C11H16ClN/c1-3-9(2)13-8-10-5-4-6-11(12)7-10/h4-7,9,13H,3,8H2,1-2H3
Synonyms:- benzenemethanamine, 3-chloro-N-(1-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
