CAS 893597-67-6
:1-(5-methylthiophen-2-yl)-N-(pyridin-4-ylmethyl)methanamine
Description:
1-(5-Methylthiophen-2-yl)-N-(pyridin-4-ylmethyl)methanamine is an organic compound characterized by its complex structure, which includes a thiophene ring and a pyridine moiety. The presence of the methylthio group enhances its solubility and may influence its reactivity and biological activity. This compound features an amine functional group, which can participate in hydrogen bonding and may affect its interaction with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heteroaromatic systems that can facilitate interactions with various biological receptors. Additionally, the compound's unique combination of functional groups may impart specific properties such as lipophilicity and polarity, influencing its pharmacokinetics and pharmacodynamics. As with many compounds containing nitrogen and sulfur, it may exhibit interesting electronic properties, making it a candidate for further research in fields such as drug design and materials science.
Formula:C12H14N2S
InChI:InChI=1/C12H14N2S/c1-10-2-3-12(15-10)9-14-8-11-4-6-13-7-5-11/h2-7,14H,8-9H2,1H3
SMILES:Cc1ccc(CNCc2ccncc2)s1
Synonyms:- 1-(5-Methyl-2-thienyl)-N-(pyridin-4-ylmethyl)methanamine
- 4-pyridinemethanamine, N-[(5-methyl-2-thienyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(5-Methylthiophen-2-yl)-N-(pyridin-4-ylmethyl)methanamine
CAS:Formula:C12H14N2SMolecular weight:218.318
