CAS 893611-64-8
:N-[(5-methylthiophen-2-yl)methyl]butan-1-amine
Description:
N-[(5-methylthiophen-2-yl)methyl]butan-1-amine, with the CAS number 893611-64-8, is a chemical compound characterized by its amine functional group and a thiophene ring structure. This compound features a butyl chain attached to a nitrogen atom, which is further connected to a methyl group that is substituted on a thiophene ring. The presence of the methylthio group enhances its potential for various chemical interactions, making it of interest in medicinal chemistry and material science. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic thiophene component, while the amine group may impart some degree of polarity. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the presence of the thiophene ring, which may participate in various chemical reactions, including electrophilic substitutions. Overall, this compound represents a unique combination of organic functionalities that could be explored for diverse applications.
Formula:C10H17NS
InChI:InChI=1/C10H17NS/c1-3-4-7-11-8-10-6-5-9(2)12-10/h5-6,11H,3-4,7-8H2,1-2H3
SMILES:CCCCNCc1ccc(C)s1
Synonyms:- 2-thiophenemethanamine, N-butyl-5-methyl-
- N-[(5-Methyl-2-thienyl)methyl]butan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
