CAS 893611-80-8

N-[(3-methylthiophen-2-yl)methyl]butan-1-amine

Description:

N-[(3-methylthiophen-2-yl)methyl]butan-1-amine, identified by its CAS number 893611-80-8, is an organic compound characterized by its amine functional group and a substituted thiophene ring. This compound features a butyl chain attached to a nitrogen atom, which is further connected to a methyl group that is linked to a 3-methylthiophen-2-yl moiety. The presence of the thiophene ring imparts unique electronic and steric properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic butyl chain and aromatic character from the thiophene. Additionally, the amine group suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, N-[(3-methylthiophen-2-yl)methyl]butan-1-amine is a structurally interesting compound with potential applications in diverse fields, warranting further investigation into its properties and behavior in different chemical environments.

Formula: C₁₀H₁₇NS

InChI: InChI=1/C10H17NS/c1-3-4-6-11-8-10-9(2)5-7-12-10/h5,7,11H,3-4,6,8H2,1-2H3

SMILES: CCCCNCc1c(C)ccs1

Synonyms:

• 2-thiophenemethanamine, N-butyl-3-methyl-
• N-[(3-Methyl-2-thienyl)methyl]butan-1-amine

N-[(3-METHYL-2-THIENYL)METHYL]-1-BUTANAMINE

CAS: 893611-80-8

Formula: C₁₀H₁₇NS

Molecular weight: 183.3137

Ref: IN-DA003XQ4

N-[(3-methyl-2-thienyl)methyl]-1-butanamine hydrochloride

CAS: 893611-80-8

Formula: C₁₀H₁₈ClNS

Purity: 95.0%

Molecular weight: 219.77

Ref: 10-F361803