CAS 893611-92-2
:3-nitro-2-(1-piperidyl)benzoic acid
Description:
3-Nitro-2-(1-piperidyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a nitro group and a piperidine moiety. The presence of the nitro group (-NO2) on the benzene ring contributes to its electrophilic properties, making it a potential candidate for various chemical reactions. The piperidine ring, a six-membered saturated nitrogen-containing heterocycle, enhances the compound's solubility in polar solvents and may influence its biological activity. As a carboxylic acid, it features a carboxyl group (-COOH), which can participate in acid-base reactions and hydrogen bonding, affecting its reactivity and interactions with other molecules. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and behavior in biological systems would depend on further studies, including its synthesis, stability, and interaction with biological targets. Overall, 3-nitro-2-(1-piperidyl)benzoic acid represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C12H14N2O4
InChI:InChI=1/C12H14N2O4/c15-12(16)9-5-4-6-10(14(17)18)11(9)13-7-2-1-3-8-13/h4-6H,1-3,7-8H2,(H,15,16)
Synonyms:- benzoic acid, 3-nitro-2-(1-piperidinyl)-
- 3-Nitro-2-(1-piperidinyl)benzoic acid
- 3-nitro-2-(piperidin-1-yl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
