CAS 893612-01-6
:5-bromo-3-(2-phenylpyrrolidin-1-yl)pyrazin-2-amine
Description:
5-Bromo-3-(2-phenylpyrrolidin-1-yl)pyrazin-2-amine is a chemical compound characterized by its complex structure, which includes a pyrazine ring substituted with a bromine atom and an amine group, as well as a pyrrolidine moiety linked to a phenyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. The presence of the bromine atom can influence its reactivity and solubility, while the pyrrolidine and phenyl groups may enhance its interaction with biological targets. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups.
Formula:C14H15BrN4
InChI:InChI=1/C14H15BrN4/c15-12-9-17-13(16)14(18-12)19-8-4-7-11(19)10-5-2-1-3-6-10/h1-3,5-6,9,11H,4,7-8H2,(H2,16,17)
Synonyms:- 5-Bromo-3-(2-phenyl-1-pyrrolidinyl)-2-pyrazinamine
- 2-pyrazinamine, 5-bromo-3-(2-phenyl-1-pyrrolidinyl)-
- 5-Brom-3-(2-phenyl-1-pyrrolidinyl)-2-pyrazinamin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
