CAS 893612-12-9

5-bromo-3-(3-methylpiperazin-1-yl)pyrazin-2-amine

Description:

5-Bromo-3-(3-methylpiperazin-1-yl)pyrazin-2-amine is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a bromine atom and a 3-methylpiperazine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amine and piperazine groups, which can engage in hydrogen bonding. The bromine substituent may influence its reactivity and biological activity, potentially enhancing lipophilicity. The piperazine ring contributes to its pharmacological profile, often associated with various biological activities, including potential use in medicinal chemistry. The compound's molecular structure suggests it may interact with biological targets, making it of interest in drug discovery and development. Additionally, its CAS number, 893612-12-9, allows for easy identification and reference in chemical databases. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₉H₁₄BrN₅

InChI: InChI=1/C9H14BrN5/c1-6-5-15(3-2-12-6)9-8(11)13-4-7(10)14-9/h4,6,12H,2-3,5H2,1H3,(H2,11,13)

Synonyms:

• 2-pyrazinamine, 5-bromo-3-(3-methyl-1-piperazinyl)-
• 5-Bromo-3-(3-methyl-1-piperazinyl)-2-pyrazinamine
• 5-Brom-3-(3-methyl-1-piperazinyl)-2-pyrazinamin