CymitQuimica logo

CAS 893612-17-4

:

5-bromo-3-[2-(3-pyridyl)pyrrolidin-1-yl]pyrazin-2-amine

Description:
5-bromo-3-[2-(3-pyridyl)pyrrolidin-1-yl]pyrazin-2-amine is a chemical compound characterized by its complex structure, which includes a pyrazine ring, a bromine substituent, and a pyrrolidine moiety linked to a pyridine ring. This compound features a bromine atom at the 5-position of the pyrazine, which can influence its reactivity and biological activity. The presence of the pyrrolidine and pyridine groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure contributes to its solubility, stability, and potential pharmacological properties. It may exhibit various biological activities, including antimicrobial or anticancer effects, depending on its specific interactions within biological systems. Additionally, the presence of nitrogen atoms in the rings can enhance its ability to form hydrogen bonds, which is crucial for binding to biological macromolecules. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.
Formula:C13H14BrN5
InChI:InChI=1/C13H14BrN5/c14-11-8-17-12(15)13(18-11)19-6-2-4-10(19)9-3-1-5-16-7-9/h1,3,5,7-8,10H,2,4,6H2,(H2,15,17)
Synonyms:
  • 5-Bromo-3-[2-(3-pyridinyl)-1-pyrrolidinyl]-2-pyrazinamine
  • 5-bromo-3-[2-(pyridin-3-yl)pyrrolidin-1-yl]pyrazin-2-amine
  • 5-Brom-3-[2-(3-pyridinyl)-1-pyrrolidinyl]-2-pyrazinamin
  • 2-pyrazinamine, 5-bromo-3-[2-(3-pyridinyl)-1-pyrrolidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.