CAS 893612-42-5
:5-amino-2-methyl-10H-acridin-9-one
Description:
5-amino-2-methyl-10H-acridin-9-one is an organic compound characterized by its acridine backbone, which is a fused ring system containing nitrogen. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the acridine structure, contributing to its chemical reactivity and potential biological activity. It typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound may display fluorescence, a common trait among acridine derivatives, making it useful in various applications, including biological imaging and as a potential therapeutic agent. Its structure suggests potential interactions with nucleic acids, which is of interest in medicinal chemistry and drug development. Additionally, the presence of the amino group may enhance its reactivity in electrophilic substitution reactions. Overall, 5-amino-2-methyl-10H-acridin-9-one is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C14H12N2O
InChI:InChI=1/C14H12N2O/c1-8-5-6-12-10(7-8)14(17)9-3-2-4-11(15)13(9)16-12/h2-7H,15H2,1H3,(H,16,17)
Synonyms:- 5-Amino-2-methyl-9(10H)-acridinone
- 5-Amino-2-methylacridin-9(10H)-one
- 5-Amino-2-methyl-9(10H)-acridinon
- 9(10H)-acridinone, 5-amino-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
