CAS 893612-47-0
:4-amino-5-chloro-10H-acridin-9-one
Description:
4-Amino-5-chloro-10H-acridin-9-one is an organic compound characterized by its acridine backbone, which is a fused ring system consisting of three benzene rings. This compound features an amino group (-NH2) and a chloro group (-Cl) that are critical for its chemical reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile, while the chloro group can influence its lipophilicity and reactivity. The compound is likely to exhibit fluorescence due to the conjugated system of the acridine structure, making it of interest in various applications, including pharmaceuticals and dyes. Its specific properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other functional groups. Overall, 4-amino-5-chloro-10H-acridin-9-one is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C13H9ClN2O
InChI:InChI=1/C13H9ClN2O/c14-9-5-1-3-7-11(9)16-12-8(13(7)17)4-2-6-10(12)15/h1-6H,15H2,(H,16,17)
Synonyms:- 4-Amino-5-chlor-9(10H)-acridinon
- 4-Amino-5-chloroacridin-9(10H)-one
- 4-Amino-5-chloro-9(10H)-acridinone
- 9(10H)-acridinone, 4-amino-5-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
