CAS 893612-52-7
:5-amino-2-chloro-10H-acridin-9-one
Description:
5-amino-2-chloro-10H-acridin-9-one is a synthetic organic compound characterized by its acridine backbone, which is a polycyclic aromatic structure. This compound features an amino group and a chlorine atom, contributing to its reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile, while the chlorine atom can influence its lipophilicity and interaction with biological targets. The compound is typically solid at room temperature and may exhibit fluorescence due to the acridine structure, which is common in many aromatic compounds. Its unique structure allows it to be investigated for various applications, including potential roles in medicinal chemistry, particularly in the development of pharmaceuticals or as a fluorescent probe in biochemical assays. As with many chemical substances, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C13H9ClN2O
InChI:InChI=1/C13H9ClN2O/c14-7-4-5-11-9(6-7)13(17)8-2-1-3-10(15)12(8)16-11/h1-6H,15H2,(H,16,17)
Synonyms:- 5-Amino-2-chloroacridin-9(10H)-one
- 5-Amino-2-chlor-9(10H)-acridinon
- 5-Amino-2-chloro-9(10H)-acridinone
- 9(10H)-acridinone, 5-amino-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
