CymitQuimica logo

CAS 893613-09-7

:

3-(2-thienyl)-6-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine

Description:
3-(2-Thienyl)-6-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine core fused with a thienyl group and a trimethoxyphenyl substituent. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of the thienyl and trimethoxyphenyl groups contributes to its potential for interacting with various biological targets, possibly influencing its pharmacological properties. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, its molecular structure suggests potential for engaging in hydrogen bonding and π-π stacking interactions, which may play a role in its biological efficacy. As with many heterocyclic compounds, it may also exhibit fluorescence properties, making it useful in various analytical applications. Overall, this compound represents a class of molecules that are valuable for exploring new therapeutic avenues.
Formula:C19H17N3O3S
InChI:InChI=1/C19H17N3O3S/c1-23-15-7-12(8-16(24-2)18(15)25-3)13-9-20-19-14(10-21-22(19)11-13)17-5-4-6-26-17/h4-11H,1-3H3
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine, 3-(2-thienyl)-6-(3,4,5-trimethoxyphenyl)-
  • 3-THIOPHEN-2-YL-6-(3,4,5-TRIMETHOXY-PHENYL)-PYRAZOLO[1,5-A]PYRIMIDINE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.