CAS 893613-13-3

6-(4-methoxyphenyl)-3-(2-thienyl)pyrazolo[1,5-a]pyrimidine

Description:

6-(4-Methoxyphenyl)-3-(2-thienyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core fused with a thienyl group and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with heterocycles, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the methoxy group can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the thienyl moiety may contribute to its electronic properties and reactivity. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. Its unique arrangement of functional groups may also impart specific pharmacological properties, making it a candidate for further investigation in therapeutic contexts. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances.

Formula: C₁₇H₁₃N₃OS

InChI: InChI=1/C17H13N3OS/c1-21-14-6-4-12(5-7-14)13-9-18-17-15(10-19-20(17)11-13)16-3-2-8-22-16/h2-11H,1H3

SMILES: COc1ccc(cc1)c1cnc2c(cnn2c1)c1cccs1

Synonyms:

• 6-(4-Methoxyphenyl)-3-(2-thienyl)pyrazolo[1,5-a]pyrimidin

6-(4-Methoxyphenyl)-3-(thiophen-2-yl)pyrazolo[1,5-a]pyrimidine

CAS: 893613-13-3

Formula: C₁₇H₁₃N₃OS

Molecular weight: 307.3696

Ref: IN-DA003X5D

6-(4-methoxyphenyl)-3-(thiophen-2-yl)pyrazolo[1,5-a]pyrimidine

CAS: 893613-13-3

Purity: 95.0%

Molecular weight: 307.3699951171875

Ref: 10-F526429