CAS 893613-29-1
:3-[2-(4-dimethylaminophenyl)pyrazolo[1,5-a]pyrimidin-6-yl]propan-1-ol
Description:
3-[2-(4-Dimethylaminophenyl)pyrazolo[1,5-a]pyrimidin-6-yl]propan-1-ol, with the CAS number 893613-29-1, is a chemical compound characterized by its complex structure, which includes a pyrazolo[1,5-a]pyrimidine core and a propanol side chain. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the dimethylamino group suggests that it may interact with biological targets, potentially influencing its pharmacological profile. Its molecular structure indicates that it may participate in hydrogen bonding due to the hydroxyl group, which can enhance its solubility in polar solvents. Additionally, the compound may exhibit specific reactivity patterns typical of pyrazolo and pyrimidine derivatives, which are often explored for their roles in drug development. Overall, this compound's unique structural features contribute to its potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C17H20N4O
InChI:InChI=1/C17H20N4O/c1-20(2)15-7-5-14(6-8-15)16-10-17-18-11-13(4-3-9-22)12-21(17)19-16/h5-8,10-12,22H,3-4,9H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-(4-(Dimethylamino)phenyl)pyrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol
CAS:Formula:C17H20N4OMolecular weight:296.3669
