CymitQuimica logo

CAS 893613-37-1

:

4-[6-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethyl-aniline

Description:
4-[6-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethyl-aniline, with the CAS number 893613-37-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrazolo-pyrimidine core and a dimethylamino group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the methoxyphenyl group may influence its electronic properties and interactions with biological targets. Its molecular structure suggests potential applications in drug development, particularly in areas related to cancer or neurological disorders, although specific biological activities would need to be confirmed through empirical studies. The compound's stability, reactivity, and pharmacokinetic properties would also be essential considerations in its development as a pharmaceutical agent. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.
Formula:C21H20N4O
InChI:InChI=1/C21H20N4O/c1-24(2)18-8-4-16(5-9-18)20-12-21-22-13-17(14-25(21)23-20)15-6-10-19(26-3)11-7-15/h4-14H,1-3H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.