CymitQuimica logo

CAS 893615-23-1

:

2-methyl-2-[(pyridin-3-ylmethyl)amino]propan-1-ol

Description:
2-Methyl-2-[(pyridin-3-ylmethyl)amino]propan-1-ol is an organic compound characterized by its complex structure, which includes a tertiary alcohol and an amine functional group. The presence of the pyridine ring contributes to its aromatic properties, while the methyl and propanol groups enhance its solubility in polar solvents. This compound typically exhibits moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. The pyridine moiety may also impart basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its CAS number, 893615-23-1, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and safety data in chemical databases. Overall, this compound exemplifies the diverse functionalities that can arise from the combination of different organic groups.
Formula:C10H16N2O
InChI:InChI=1/C10H16N2O/c1-10(2,8-13)12-7-9-4-3-5-11-6-9/h3-6,12-13H,7-8H2,1-2H3
SMILES:CC(C)(CO)NCc1cccnc1
Synonyms:
  • 1-Propanol, 2-Methyl-2-[(3-Pyridinylmethyl)Amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.