CAS 893620-30-9
:2-chloro-4-fluoroquinoline
Description:
2-Chloro-4-fluoroquinoline is a heterocyclic organic compound that belongs to the quinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. This compound features a chlorine atom at the 2-position and a fluorine atom at the 4-position of the quinoline ring, which contributes to its unique chemical properties. It is typically a pale yellow to light brown solid, and its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. The presence of halogen substituents can influence its reactivity, solubility, and biological activity, potentially enhancing its efficacy in pharmaceutical applications. Additionally, 2-chloro-4-fluoroquinoline may exhibit antimicrobial or antiviral properties, making it a candidate for further research in drug development. As with many halogenated compounds, it is important to handle this substance with care due to potential toxicity and environmental impact. Proper safety protocols should be followed when working with this chemical.
Formula:C9H5ClFN
InChI:InChI=1/C9H5ClFN/c10-9-5-7(11)6-3-1-2-4-8(6)12-9/h1-5H
SMILES:c1ccc2c(c1)c(cc(Cl)n2)F
Synonyms:- Quinoline, 2-Chloro-4-Fluoro-
- T66 Bnj Cg Ef [Wln]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
