CAS 893631-64-6

2-(Methoxymethyl)-1H-benzimidazole-1-butanoic acid

Description:

2-(Methoxymethyl)-1H-benzimidazole-1-butanoic acid, identified by its CAS number 893631-64-6, is a chemical compound that features a benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound is characterized by the presence of a methoxymethyl group and a butanoic acid moiety, contributing to its unique chemical properties. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure, while the carboxylic acid group may impart some degree of hydrophilicity. The presence of the methoxymethyl group can influence its reactivity and potential interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its structural features suggest potential applications in medicinal chemistry, where modifications to the benzimidazole scaffold can lead to varied biological activities. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₃H₁₆N₂O₃

InChI: InChI=1S/C13H16N2O3/c1-18-9-12-14-10-5-2-3-6-11(10)15(12)8-4-7-13(16)17/h2-3,5-6H,4,7-9H2,1H3,(H,16,17)

InChI key: InChIKey=REWVEHLZLYFMMC-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)N1C=2C(N=C1COC)=CC=CC2

Synonyms:

• 2-(Methoxymethyl)-1H-benzimidazole-1-butanoic acid
• 1H-Benzimidazole-1-butanoic acid, 2-(methoxymethyl)-