CymitQuimica logo

CAS 893637-83-7

:

2-Fluoro-4-(3-pyridinyl)benzaldehyde

Description:
2-Fluoro-4-(3-pyridinyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a pyridine ring. The presence of a fluorine atom at the 2-position of the benzene ring influences its reactivity and polarity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic components. Its molecular structure allows for potential interactions in biological systems, making it of interest in the development of pharmaceuticals. The compound's reactivity can be attributed to the electrophilic nature of the aldehyde group and the electron-withdrawing effect of the fluorine atom, which can enhance its ability to participate in various chemical reactions, including nucleophilic additions and substitutions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C12H8FNO
InChI:InChI=1S/C12H8FNO/c13-12-6-9(3-4-11(12)8-15)10-2-1-5-14-7-10/h1-8H
InChI key:InChIKey=UUJAUHRIAPLPIU-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C=O)C=2C=CC=NC2
Synonyms:
  • 2-Fluoro-4-(3-pyridinyl)benzaldehyde
  • Benzaldehyde, 2-fluoro-4-(3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.