CymitQuimica logo

CAS 893637-97-3

:

4'-chloro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid

Description:
4'-Chloro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position of one of the phenyl rings imparts acidic properties to the molecule. Additionally, the compound features a chloro substituent at the 4' position and a trifluoromethyl group (-CF3) at the 3' position of the biphenyl moiety, which can significantly influence its chemical reactivity and physical properties. The trifluoromethyl group is known for enhancing lipophilicity and altering the electronic characteristics of the compound, potentially affecting its interactions in biological systems. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features and potential applications. Its CAS number, 893637-97-3, allows for easy identification in chemical databases and literature.
Formula:C14H8ClF3O2
InChI:InChI=1/C14H8ClF3O2/c15-12-5-4-9(7-11(12)14(16,17)18)8-2-1-3-10(6-8)13(19)20/h1-7H,(H,19,20)
SMILES:c1cc(cc(c1)C(=O)O)c1ccc(c(c1)C(F)(F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.