CymitQuimica logo

CAS 893638-28-3

:

4-hydroxy-3',5'-bis(trifluoromethyl)biphenyl-3-carboxylic acid

Description:
4-Hydroxy-3',5'-bis(trifluoromethyl)biphenyl-3-carboxylic acid, with the CAS number 893638-28-3, is an organic compound characterized by its biphenyl structure substituted with hydroxy and trifluoromethyl groups. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of two trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The hydroxy group can participate in hydrogen bonding, affecting solubility and interaction with other molecules. Additionally, the compound's unique structure may impart specific electronic properties, making it suitable for applications in materials science or as a building block in organic synthesis. Its stability and reactivity can be influenced by the steric and electronic effects of the trifluoromethyl groups, which are known to be strong electron-withdrawing groups. Overall, this compound's distinctive features make it a subject of interest in various fields of chemistry.
Formula:C15H8F6O3
InChI:InChI=1/C15H8F6O3/c16-14(17,18)9-3-8(4-10(6-9)15(19,20)21)7-1-2-12(22)11(5-7)13(23)24/h1-6,22H,(H,23,24)
SMILES:c1cc(c(cc1c1cc(cc(c1)C(F)(F)F)C(F)(F)F)C(=O)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.