CAS 893639-01-5

1-[5-(2-methylpropyl)-1,2-oxazol-3-yl]methanamine

Description:

1-[5-(2-methylpropyl)-1,2-oxazol-3-yl]methanamine, with the CAS number 893639-01-5, is a chemical compound characterized by its unique structural features, including an oxazole ring and an amine functional group. The presence of the 2-methylpropyl substituent contributes to its hydrophobic characteristics, which may influence its solubility and interaction with biological systems. The oxazole ring, a five-membered heterocyclic compound containing nitrogen and oxygen, is known for its potential biological activity, making this compound of interest in medicinal chemistry. The methanamine group indicates that it has basic properties, which can affect its reactivity and interactions with other molecules. Overall, this compound's specific characteristics, including its molecular structure and functional groups, suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₈H₁₄N₂O

InChI: InChI=1/C8H14N2O/c1-6(2)3-8-4-7(5-9)10-11-8/h4,6H,3,5,9H2,1-2H3

SMILES: CC(C)Cc1cc(CN)no1

Synonyms:

• 3-Isoxazolemethanamine, 5-(2-Methylpropyl)-

[5-(2-methylpropyl)-1,2-oxazol-3-yl]methanamine

CAS: 893639-01-5

Formula: C₈H₁₄N₂O

Molecular weight: 154.2096

Ref: IN-DA003X53