CAS 89364-93-2
:2-Methyl-1,3-dioxolane-2-carboxylic acid hydrazide
Description:
2-Methyl-1,3-dioxolane-2-carboxylic acid hydrazide is an organic compound characterized by its unique structure, which includes a dioxolane ring and a hydrazide functional group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and may have moderate stability under standard conditions. The presence of the hydrazide group suggests potential reactivity, particularly in forming hydrazones or participating in condensation reactions. Its dioxolane moiety contributes to its cyclic nature, which can influence its chemical reactivity and interactions with other molecules. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its functional groups. Additionally, the presence of both hydrazide and carboxylic acid functionalities may impart biological activity, making it of interest in medicinal chemistry. As with any chemical, proper handling and safety measures should be observed due to potential hazards associated with its use.
Formula:C5H10N2O3
InChI:InChI=1S/C5H10N2O3/c1-5(4(8)7-6)9-2-3-10-5/h2-3,6H2,1H3,(H,7,8)
InChI key:InChIKey=CPNBPOUCDZVVSQ-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1(C)OCCO1
Synonyms:- 1,3-Dioxolane-2-carboxylic acid, 2-methyl-, hydrazide
- 2-Methyl-1,3-dioxolane-2-carboxylic acid hydrazide
- 2-Methyl-1,3-dioxolane-2-carbohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
