CAS 893641-20-8

β,3,5-Trimethyl-4-isoxazoleethanamine

Description:

β,3,5-Trimethyl-4-isoxazoleethanamine, with the CAS number 893641-20-8, is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. This compound features a trimethyl substitution pattern on the isoxazole ring, which may influence its solubility and reactivity. The presence of an ethanamine group suggests that it may exhibit amine-like properties, potentially allowing for interactions with biological targets such as receptors or enzymes. The compound's molecular structure indicates it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, understanding its behavior in various solvents and under different conditions is crucial for applications in research and industry. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₈H₁₄N₂O

InChI: InChI=1S/C8H14N2O/c1-5(4-9)8-6(2)10-11-7(8)3/h5H,4,9H2,1-3H3

InChI key: InChIKey=LEVUYGBVOMFQGU-UHFFFAOYSA-N

SMILES: C(CN)(C)C=1C(C)=NOC1C

Synonyms:

• 4-Isoxazoleethanamine, β,3,5-trimethyl-
• β,3,5-Trimethyl-4-isoxazoleethanamine

2-(Dimethyl-1,2-oxazol-4-yl)propan-1-amine

CAS: 893641-20-8

Versatile small molecule scaffold

Formula: C₈H₁₄N₂O

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-TKB64120