CAS 893641-32-2

N,3,5-Trimethyl-4-isoxazolemethanamine

Description:

N,3,5-Trimethyl-4-isoxazolemethanamine is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. The presence of three methyl groups at the N and C positions enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. The isoxazole moiety is known for its role in various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the amine functional group can participate in hydrogen bonding, which may affect its reactivity and interaction with other molecules. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other chemical species. Further research would be necessary to fully elucidate its properties and potential uses in various fields, including drug development and materials science.

Formula: C₇H₁₂N₂O

InChI: InChI=1S/C7H12N2O/c1-5-7(4-8-3)6(2)10-9-5/h8H,4H2,1-3H3

InChI key: InChIKey=KUSBHINLXPYBKU-UHFFFAOYSA-N

SMILES: C(NC)C=1C(C)=NOC1C

Synonyms:

• (3,5-Dimethyl-isoxazol-4-ylmethyl)-methyl-amine
• 4-Isoxazolemethanamine, N,3,5-trimethyl-
• [(Dimethyl-1,2-oxazol-4-yl)methyl](methyl)amine
• N,3,5-Trimethyl-4-isoxazolemethanamine
• 3,5-Dimethyl-4-(methylaminomethyl)isoxazole

N-[(3,5-Dimethylisoxazol-4-yl)methyl]-N-methylamine hydrochloride

CAS: 893641-32-2

N-[(3,5-Dimethylisoxazol-4-yl)methyl]-N-methylamine hydrochloride

Purity: 95%

Molecular weight: 176.64g/mol

Ref: 54-OR932076