CymitQuimica logo

CAS 893641-34-4

:

4′-Methyl[1,1′-biphenyl]-4-propanoic acid

Description:
4′-Methyl[1,1′-biphenyl]-4-propanoic acid, identified by its CAS number 893641-34-4, is an organic compound characterized by its biphenyl structure with a methyl group and a propanoic acid functional group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with a methyl substituent at the para position of one of the phenyl rings and a propanoic acid group at the para position of the other. The presence of the propanoic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound's physical properties, such as solubility and melting point, can vary based on the specific conditions and purity. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C16H16O2
InChI:InChI=1S/C16H16O2/c1-12-2-7-14(8-3-12)15-9-4-13(5-10-15)6-11-16(17)18/h2-5,7-10H,6,11H2,1H3,(H,17,18)
InChI key:InChIKey=PJGTWJUYKKIZFL-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=CC=C(C=C1)C2=CC=C(C)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-propanoic acid, 4′-methyl-
  • 4′-Methyl[1,1′-biphenyl]-4-propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.