
CAS 89365-49-1
:Phenol, 2,4,6-tribromo-, sodium salt (1:1)
Description:
Phenol, 2,4,6-tribromo-, sodium salt (1:1), with the CAS number 89365-49-1, is a chemical compound characterized by its brominated phenolic structure. This compound features three bromine atoms substituted at the 2, 4, and 6 positions of the phenol ring, which significantly enhances its reactivity and alters its physical properties. As a sodium salt, it is typically soluble in water, making it useful in various applications, including as a biocide or antimicrobial agent. The presence of bromine atoms contributes to its potential toxicity and environmental persistence. In terms of safety, it is important to handle this compound with care, as it may pose health risks upon exposure. Its applications may extend to fields such as agriculture, where it can be used in formulations for pest control. Overall, the unique structure and properties of 2,4,6-tribromo-phenol sodium salt make it a compound of interest in both industrial and research settings.
Formula:C6H3Br3O·Na
InChI:InChI=1S/C6H3Br3O.Na/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H;
InChI key:InChIKey=DTPLBCZMYBPSNG-UHFFFAOYSA-N
SMILES:OC1=C(Br)C=C(Br)C=C1Br.[Na]
Synonyms:- 2,4,6-Tribromophenol sodium salt
- Phenol, 2,4,6-tribromo-, sodium salt (1:1)
- Phenol, 2,4,6-tribromo-, sodium salt
- Sodium 2,4,6-tribromophenoxide
- Sodium, (2,4,6-tribromophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
