
CAS 89369-45-9
:Ethyl 2-[[2-[(methylsulfonyl)amino]benzoyl]amino]benzoate
Description:
Ethyl 2-[[2-[(methylsulfonyl)amino]benzoyl]amino]benzoate, identified by its CAS number 89369-45-9, is a chemical compound that belongs to the class of benzoate esters. This substance features a complex structure characterized by the presence of an ethyl ester group, two amino groups, and a methylsulfonyl moiety, which contribute to its unique chemical properties. The compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its polar and non-polar characteristics. Ethyl 2-[[2-[(methylsulfonyl)amino]benzoyl]amino]benzoate may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could lead to various applications in medicinal chemistry. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with exposure.
Formula:C17H18N2O5S
InChI:InChI=1S/C17H18N2O5S/c1-3-24-17(21)13-9-5-6-10-14(13)18-16(20)12-8-4-7-11-15(12)19-25(2,22)23/h4-11,19H,3H2,1-2H3,(H,18,20)
InChI key:InChIKey=MHDUPYHBAPIONE-UHFFFAOYSA-N
SMILES:N(C(=O)C1=C(NS(C)(=O)=O)C=CC=C1)C2=C(C(OCC)=O)C=CC=C2
Synonyms:- 2-(2-Methanesulfonylamino-benzoylamino)-benzoic acid ethyl ester
- Ethyl 2-[[2-[(methylsulfonyl)amino]benzoyl]amino]benzoate
- Benzoic acid, 2-[[2-[(methylsulfonyl)amino]benzoyl]amino]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid,2-[[2-[(methylsulfonyl)amino]benzoyl]amino]-, ethyl ester
CAS:Formula:C17H18N2O5SMolecular weight:362.4002
