CAS 89371-35-7

benzyl (4S)-1-methyl-2-oxo-imidazolidine-4-carboxylate

Description:

Benzyl (4S)-1-methyl-2-oxo-imidazolidine-4-carboxylate is a chemical compound characterized by its imidazolidine core structure, which features a five-membered ring containing two nitrogen atoms. This compound is typically classified as an imidazolidine derivative and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the benzyl group enhances its lipophilicity, which can influence its biological activity and solubility. The (4S) configuration indicates specific stereochemistry, which is crucial for its reactivity and interaction with biological targets. The carboxylate functional group contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. Overall, this compound's unique structural features make it a valuable intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Its CAS number, 89371-35-7, serves as a unique identifier for regulatory and research purposes.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1/C12H14N2O3/c1-14-7-10(13-12(14)16)11(15)17-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,13,16)/t10-/m0/s1

SMILES: CN1C[C@@H](C(=O)OCc2ccccc2)N=C1O

Synonyms:

• Benzyl (4S)-1-methyl-2-oxoimidazolidine-4-carboxylate

(S)-1-METHYL-2-OXO-IMIDAZOLIDINE-4-CARBOXYLIC ACID BENZYL ESTER

CAS: 89371-35-7

Formula: C₁₂H₁₄N₂O₃

Molecular weight: 234.2512

Ref: IN-DA003XKN