CAS 89371-42-6

(2S)-2-[[(1S)-1-benzyloxycarbonyl-3-phenyl-propyl]amino]propanoic acid

Description:

The chemical substance known as (2S)-2-[[(1S)-1-benzyloxycarbonyl-3-phenyl-propyl]amino]propanoic acid, with the CAS number 89371-42-6, is an amino acid derivative characterized by its chiral centers, which contribute to its stereochemistry. This compound features a propanoic acid backbone, with an amino group and a benzyloxycarbonyl protecting group attached to the side chain. The presence of the phenyl group enhances its hydrophobic characteristics, while the benzyloxycarbonyl group serves as a protective moiety, often used in peptide synthesis to prevent unwanted reactions. The compound is likely to exhibit solubility in organic solvents and may have limited solubility in water due to its hydrophobic components. Its stereochemistry suggests potential biological activity, making it of interest in pharmaceutical applications, particularly in the design of peptide-based drugs. Overall, this compound's unique structure and functional groups make it a valuable candidate for further research in medicinal chemistry and related fields.

Formula: C₂₀H₂₃NO₄

InChI: InChI=1/C20H23NO4/c1-15(19(22)23)21-18(13-12-16-8-4-2-5-9-16)20(24)25-14-17-10-6-3-7-11-17/h2-11,15,18,21H,12-14H2,1H3,(H,22,23)/t15-,18-/m0/s1

SMILES: C[C@@H](C(=O)O)N[C@@H](CCc1ccccc1)C(=O)OCc1ccccc1