CymitQuimica logo

CAS 893725-41-2

:

1-(4-Bromophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidine-4-thione

Description:
1-(4-Bromophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidine-4-thione is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a thione functional group. This compound features a bromophenyl substituent, contributing to its potential reactivity and biological activity. The presence of the thione group (–C=S) suggests that it may exhibit properties typical of thioketones, including potential nucleophilicity and involvement in various chemical reactions. The dihydro form indicates that the compound has a saturated ring system, which can influence its stability and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to interactions with biological targets. Additionally, its bromine atom may enhance lipophilicity and facilitate interactions in biological systems. Overall, 1-(4-Bromophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidine-4-thione presents a diverse range of chemical properties that could be explored for various applications in pharmaceuticals and materials science.
Formula:C11H7BrN4S
InChI:InChI=1S/C11H7BrN4S/c12-7-1-3-8(4-2-7)16-10-9(5-15-16)11(17)14-6-13-10/h1-6H,(H,13,14,17)
InChI key:InChIKey=UGVTVGMJFRFECT-UHFFFAOYSA-N
SMILES:S=C1C2=C(N(N=C2)C3=CC=C(Br)C=C3)NC=N1
Synonyms:
  • 1-(4-Bromophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidine-4-thione
  • 4H-Pyrazolo[3,4-d]pyrimidine-4-thione, 1-(4-bromophenyl)-1,5-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.