CAS 893725-50-3

3-Methyl-1-(2-methylphenyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid

Description:

3-Methyl-1-(2-methylphenyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[2,3-c]pyrazole core. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methyl group and a 2-methylphenyl substituent enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity. The thieno and pyrazole rings provide unique electronic properties, making it of interest in medicinal chemistry, particularly for its potential biological activities. The compound may exhibit various pharmacological effects, which are often investigated in drug development contexts. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many organic compounds, the stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Overall, 3-Methyl-1-(2-methylphenyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid represents a significant structure in the field of organic and medicinal chemistry.

Formula: C₁₄H₁₂N₂O₂S

InChI: InChI=1S/C14H12N2O2S/c1-8-5-3-4-6-11(8)16-13-10(9(2)15-16)7-12(19-13)14(17)18/h3-7H,1-2H3,(H,17,18)

InChI key: InChIKey=VNOUZONDYAPHRE-UHFFFAOYSA-N

SMILES: CC=1C2=C(N(N1)C3=C(C)C=CC=C3)SC(C(O)=O)=C2

Synonyms:

• 3-Methyl-1-(2-methylphenyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid
• 1H-Thieno[2,3-c]pyrazole-5-carboxylic acid, 3-methyl-1-(2-methylphenyl)-

3-Methyl-1-(2-methylphenyl)-1H-thieno[2,3-c]pyrazole-5-carboxylic acid

CAS: 893725-50-3

Versatile small molecule scaffold

Formula: C₁₄H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 272.32 g/mol

Ref: 3D-TKB72550