CAS 893725-93-4

N-[4-(acetylamino)phenyl]-3-chloropropanamide

Description:

N-[4-(Acetylamino)phenyl]-3-chloropropanamide, identified by its CAS number 893725-93-4, is a chemical compound that features a phenyl ring substituted with an acetylamino group and a chloropropanamide moiety. This compound typically exhibits characteristics associated with amides, such as moderate solubility in polar solvents due to the presence of the amide functional group, which can engage in hydrogen bonding. The acetylamino group contributes to its potential biological activity, possibly influencing its interaction with biological targets. The presence of the chlorine atom in the propanamide chain may enhance lipophilicity and affect the compound's reactivity and stability. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of therapeutic agents, due to its structural features that suggest potential for specific biological interactions. As with many organic compounds, its physical properties, such as melting point and boiling point, would depend on the molecular structure and intermolecular forces present.

Formula: C₁₁H₁₃ClN₂O₂

InChI: InChI=1/C11H13ClN2O2/c1-8(15)13-9-2-4-10(5-3-9)14-11(16)6-7-12/h2-5H,6-7H2,1H3,(H,13,15)(H,14,16)

SMILES: CC(=Nc1ccc(cc1)NC(=O)CCCl)O

N-[4-(acetylamino)phenyl]-3-chloropropanamide

CAS: 893725-93-4

Formula: C₁₁H₁₃ClN₂O₂

Purity: 95.0%

Molecular weight: 240.69

Ref: 10-F315425