CymitQuimica logo

CAS 893729-95-8

:

5-(2-Thiazolyl)-2-furancarboxylic acid

Description:
5-(2-Thiazolyl)-2-furancarboxylic acid is a heterocyclic compound characterized by the presence of both a thiazole and a furan ring in its structure. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The compound may display acidic properties due to the carboxylic acid group, allowing it to participate in acid-base reactions. Additionally, its unique structure may impart specific reactivity patterns, making it of interest in synthetic organic chemistry. The compound's molecular interactions and stability can be influenced by factors such as pH and temperature. Overall, 5-(2-Thiazolyl)-2-furancarboxylic acid is a valuable compound for research, particularly in medicinal chemistry and material science, due to its diverse functional groups and potential applications.
Formula:C8H5NO3S
InChI:InChI=1S/C8H5NO3S/c10-8(11)6-2-1-5(12-6)7-9-3-4-13-7/h1-4H,(H,10,11)
InChI key:InChIKey=JTSWSQYKAHAQDQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=CC1)C2=NC=CS2
Synonyms:
  • 5-(2-Thiazolyl)-2-furancarboxylic acid
  • 2-Furancarboxylic acid, 5-(2-thiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.