CAS 893732-31-5

3-Formyl-5,6-dimethoxy-1-methyl-1H-indole-2-carboxylic acid

Description:

3-Formyl-5,6-dimethoxy-1-methyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a formyl group (-CHO) at the 3-position, two methoxy groups (-OCH3) at the 5 and 6 positions, and a carboxylic acid group (-COOH) at the 2-position of the indole ring. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methoxy groups enhance the compound's solubility and may influence its biological activity. Additionally, the methyl group at the 1-position of the indole ring can affect the compound's steric and electronic properties. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest for further research in drug development and related fields.

Formula: C₁₃H₁₃NO₅

InChI: InChI=1S/C13H13NO5/c1-14-9-5-11(19-3)10(18-2)4-7(9)8(6-15)12(14)13(16)17/h4-6H,1-3H3,(H,16,17)

InChI key: InChIKey=PIFAAUWXUPQVPX-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(N(C)C1C(O)=O)=CC(OC)=C(OC)C2

Synonyms:

• 3-Formyl-5,6-dimethoxy-1-methyl-1H-indole-2-carboxylic acid
• 1H-Indole-2-carboxylic acid, 3-formyl-5,6-dimethoxy-1-methyl-