CAS 893734-58-2
:2-Furancarboxylic acid, 5-(4-chloro-3-fluorophenyl)-
Description:
2-Furancarboxylic acid, 5-(4-chloro-3-fluorophenyl)-, identified by CAS number 893734-58-2, is an organic compound featuring a furan ring substituted with a carboxylic acid group and a phenyl group that contains both chlorine and fluorine substituents. This compound typically exhibits characteristics common to both furan derivatives and aromatic compounds, including potential acidity due to the carboxylic acid functional group. The presence of the halogen substituents (chlorine and fluorine) can influence its reactivity, polarity, and solubility in various solvents. The compound may also display interesting biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests it could participate in various chemical reactions, such as esterification or nucleophilic substitutions, due to the functional groups present. Additionally, the specific arrangement of substituents can affect its electronic properties, potentially impacting its interactions in biological systems or materials science applications.
Formula:C11H6ClFO3
InChI:InChI=1S/C11H6ClFO3/c12-7-2-1-6(5-8(7)13)9-3-4-10(16-9)11(14)15/h1-5H,(H,14,15)
InChI key:InChIKey=MDDXHTQNUWCZAW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=CC1)C2=CC(F)=C(Cl)C=C2
Synonyms:- 2-Furancarboxylic acid, 5-(4-chloro-3-fluorophenyl)-
- 5-(4-Chloro-3-fluorophenyl)furan-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(4-Chloro-3-fluorophenyl)-2-furoic Acid
CAS:Controlled ProductApplications 5-(4-Chloro-3-fluorophenyl)-2-furoic Acid is an impurity of 5-(3-Chlorophenyl)-2-furoic Acid (C378150); a reagent in the synthesis of Dantrolene (D185000) which has the potential to treat vascular dysfunction.
References Ellis, K.O., et al.: J. Pharm. Sci., 69, 327 (1980); Harrison, G.G., et al.: Brit. J. Anaesth., 60, 279 (1988); Murasawa, S., et al.: Bioorg. Med. Chem., 20, 6384 (2012)Formula:C11H6ClFO3Color and Shape:NeatMolecular weight:240.61
