CymitQuimica logo

CAS 893735-92-7

:

2-(5-Pyrimidinyl)benzenamine

Description:
2-(5-Pyrimidinyl)benzenamine, with the CAS number 893735-92-7, is an organic compound characterized by the presence of both a pyrimidine and an aniline moiety. This compound features a pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3, attached to a benzene ring via an amino group (-NH2). The presence of the pyrimidine ring imparts unique electronic properties, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential for biological activity, and it may serve as a scaffold for the development of drugs targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the rings, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c11-10-4-2-1-3-9(10)8-5-12-7-13-6-8/h1-7H,11H2
InChI key:InChIKey=NVINBAORPLURBA-UHFFFAOYSA-N
SMILES:NC1=C(C=2C=NC=NC2)C=CC=C1
Synonyms:
  • 2-(5-Pyrimidinyl)benzenamine
  • Benzenamine, 2-(5-pyrimidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.