
CAS 893736-45-3
:3-(2,3-Dihydro-2,3-dioxo-1H-indol-5-yl)benzaldehyde
Description:
3-(2,3-Dihydro-2,3-dioxo-1H-indol-5-yl)benzaldehyde, with the CAS number 893736-45-3, is an organic compound characterized by its complex structure, which includes an indole moiety and a benzaldehyde functional group. This compound features a bicyclic indole structure that is substituted with a benzaldehyde group, contributing to its potential reactivity and biological activity. The presence of the dioxo groups indicates that it may participate in various chemical reactions, including oxidation and reduction processes. Typically, compounds like this may exhibit interesting properties such as fluorescence or the ability to form hydrogen bonds, which can influence their solubility and interaction with biological targets. The compound may also be of interest in medicinal chemistry due to its potential pharmacological properties, although specific biological activities would require further investigation. Overall, its unique structural features suggest that it could be a valuable compound for research in organic synthesis and drug development.
Formula:C15H9NO3
InChI:InChI=1S/C15H9NO3/c17-8-9-2-1-3-10(6-9)11-4-5-13-12(7-11)14(18)15(19)16-13/h1-8H,(H,16,18,19)
InChI key:InChIKey=VLTMQWVANWXKEQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(C2)C3=CC(C=O)=CC=C3)NC1=O
Synonyms:- Benzaldehyde, 3-(2,3-dihydro-2,3-dioxo-1H-indol-5-yl)-
- 3-(2,3-Dihydro-2,3-dioxo-1H-indol-5-yl)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
