
CAS 893736-71-5
:4-(4-Chlorophenyl)-2-thiophenecarboxaldehyde
Description:
4-(4-Chlorophenyl)-2-thiophenecarboxaldehyde is an organic compound characterized by its unique structure, which includes a thiophene ring and a chlorophenyl group. This compound features a carboxaldehyde functional group, making it an aldehyde, which is known for its reactivity and ability to participate in various chemical reactions, such as nucleophilic addition. The presence of the chlorophenyl moiety contributes to its electronic properties, potentially enhancing its reactivity due to the electron-withdrawing nature of the chlorine atom. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Additionally, its distinct structural features may allow for applications in organic synthesis and materials science. The compound is typically handled with standard safety precautions due to the presence of the chlorinated aromatic system, which can pose environmental and health risks. Overall, 4-(4-Chlorophenyl)-2-thiophenecarboxaldehyde is a versatile compound with potential applications in various fields of chemistry.
Formula:C11H7ClOS
InChI:InChI=1S/C11H7ClOS/c12-10-3-1-8(2-4-10)9-5-11(6-13)14-7-9/h1-7H
InChI key:InChIKey=MWCDXOIPVFKGJT-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CS1)C2=CC=C(Cl)C=C2
Synonyms:- 2-Thiophenecarboxaldehyde, 4-(4-chlorophenyl)-
- 4-(4-Chlorophenyl)thiophene-2-carboxaldehyde
- 4-(4-Chlorophenyl)-2-thiophenecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.