CAS 893736-72-6
:2′-Hydroxy[1,1′-biphenyl]-3-carboxylic acid
Description:
2′-Hydroxy[1,1′-biphenyl]-3-carboxylic acid, also known by its CAS number 893736-72-6, is an organic compound characterized by the presence of a biphenyl structure with hydroxyl and carboxylic acid functional groups. This compound typically exhibits properties associated with both phenolic and carboxylic acids, such as solubility in polar solvents and potential acidity due to the carboxyl group. The hydroxyl group contributes to its ability to form hydrogen bonds, enhancing its solubility in water and other polar solvents. Additionally, the biphenyl framework may impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. The compound may also exhibit biological activity, which could be relevant for research in medicinal chemistry. Its structural features suggest potential for further functionalization, making it a versatile building block in organic synthesis. Overall, 2′-Hydroxy[1,1′-biphenyl]-3-carboxylic acid is a compound of interest due to its chemical properties and potential applications.
Formula:C13H10O3
InChI:InChI=1S/C13H10O3/c14-12-7-2-1-6-11(12)9-4-3-5-10(8-9)13(15)16/h1-8,14H,(H,15,16)
InChI key:InChIKey=OCZVWZVTEQXRPI-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC(C(O)=O)=CC=C2)C=CC=C1
Synonyms:- 2′-Hydroxy[1,1′-biphenyl]-3-carboxylic acid
- 3-(2-Hydroxyphenyl)benzoic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 2′-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2'-[Hydroxybiphenyl]-3-carboxylic acid (2'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid)
CAS:Carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides etc, nesoiFormula:C13H10O3Color and Shape:Off-White SolidMolecular weight:214.062992'-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid
CAS:Formula:C13H10O3Color and Shape:SolidMolecular weight:214.2167Eltrombopag Impurity 12
CAS:Formula:C13H10O3Color and Shape:White To Off-White SolidMolecular weight:214.222'-Hydroxybiphenyl-3-carboxylic Acid
CAS:Applications 2'-Hydroxybiphenyl-3-carboxylic acid
Formula:C13H10O3Color and Shape:NeatMolecular weight:214.222'-Hydroxy[1,1'-biphenyl]-3-carboxylic acid
CAS:2'-Hydroxy[1,1'-biphenyl]-3-carboxylic acid (HBC) is a linear model that can be used to describe the deployment of cables. Techniques such as simulations, algorithms, and positioning are used to create HBC models. HBC is an algorithm that calculates the mathematical model for a cable's trajectory in water. The kinetic energy of the cable is calculated by using the HBC model and its position at a given time. The mathematical model of the cable's motion underwater also includes factors such as buoyancy, drag force, and electrostatic forces on the cable.Formula:C13H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:214.22 g/mol






