CAS 893736-91-9

[2,3′-Bithiophene]-5′-carboxaldehyde

Description:

[2,3′-Bithiophene]-5′-carboxaldehyde is an organic compound characterized by its bithiophene structure, which consists of two thiophene rings connected by a single bond. This compound features a carboxaldehyde functional group (-CHO) at the 5′ position, which contributes to its reactivity and potential applications in organic synthesis and materials science. The presence of the thiophene rings imparts notable electronic properties, making it of interest in the development of organic semiconductors and photovoltaic materials. Additionally, the compound may exhibit interesting optical properties due to the conjugated system formed by the thiophene units. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, [2,3′-Bithiophene]-5′-carboxaldehyde is a versatile compound with potential uses in organic electronics, sensors, and as a building block in the synthesis of more complex organic molecules.

Formula: C₉H₆OS₂

InChI: InChI=1S/C9H6OS2/c10-5-8-4-7(6-12-8)9-2-1-3-11-9/h1-6H

InChI key: InChIKey=BTZMKZIXZVISIV-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CS1)C2=CC=CS2

Synonyms:

• [2,3′-Bithiophene]-5′-carboxaldehyde