CAS 893737-71-8

4′-(Acetylamino)[1,1′-biphenyl]-3-carboxylic acid

Description:

4′-(Acetylamino)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an acetylamino group at the para position and a carboxylic acid group at the meta position contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit both acidic and basic properties due to the carboxylic acid functional group, which can donate protons, and the acetylamino group, which can participate in hydrogen bonding. The molecular structure suggests that it may have applications in pharmaceuticals or as a building block in organic synthesis. Additionally, the compound's solubility and stability can be influenced by the presence of these functional groups, making it important for various chemical reactions and interactions. Its CAS number, 893737-71-8, allows for easy identification and reference in chemical databases and literature.

Formula: C₁₅H₁₃NO₃

InChI: InChI=1S/C15H13NO3/c1-10(17)16-14-7-5-11(6-8-14)12-3-2-4-13(9-12)15(18)19/h2-9H,1H3,(H,16,17)(H,18,19)

InChI key: InChIKey=ZIZLPMUXPKXCNP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1)C2=CC=C(NC(C)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 4′-(acetylamino)-
• 4′-(Acetylamino)[1,1′-biphenyl]-3-carboxylic acid

4'-Acetamidobiphenyl-3-carboxylic acid

CAS: 893737-71-8

Formula: C₁₅H₁₃NO₃

Molecular weight: 255.2686

Ref: IN-DA00694K